C28H44O8 — CID 139249730
methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-methoxy-2-[(3E)-2-methylnona-3,8-dien-2-yl]-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-4-ylidene]acetate (PubChem CID 139249730) has the molecular formula C28H44O8 and a molecular weight of 508.65 g/mol. Its IUPAC name is methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-methoxy-2-[(3E)-2-methylnona-3,8-dien-2-yl]-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-4-ylidene]acetate.
| Compound Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-methoxy-2-[(3E)-2-methylnona-3,8-dien-2-yl]-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-4-ylidene]acetate |
|---|---|
| PubChem CID | 139249730 |
| Molecular Formula | C28H44O8 |
| Molecular Weight | 508.65 g/mol |
| Exact Mass | 508.30 |
| IUPAC Name | methyl (2E)-2-[(2S,3S,6S)-3-acetyloxy-2-methoxy-2-[(3E)-2-methylnona-3,8-dien-2-yl]-6-[[(4R,5R)-2,2,5-trimethyl-1,3-dioxolan-4-yl]methyl]oxan-4-ylidene]acetate |
| SMILES | C=CCCC/C=C/C(C)(C)[C@]1(OC)O[C@H](C[C@H]2OC(C)(C)O[C@@H]2C)C/C(=C\C(=O)OC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H44O8/c1-10-11-12-13-14-15-26(4,5)28(32-9)25(33-20(3)29)21(17-24(30)31-8)16-22(35-28)18-23-19(2)34-27(6,7)36-23/h10,14-15,17,19,22-23,25H,1,11-13,16,18H2,2-9H3/b15-14+,21-17+/t19-,22+,23-,25+,28-/m1/s1 |
| InChIKey | ZFAIQGKPTFMDIS-HGWFCBERSA-N |
| XLogP | 5.02 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.65 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|