C26H40O8 — CID 53325051
[(1R,2R,3E,7Z,9R)-6-acetyloxy-2-methoxy-9-(2-methoxyethoxymethoxy)-11,14,14-trimethyl-5-bicyclo[8.3.1]tetradeca-3,7,10-trienyl] acetate (PubChem CID 53325051) has the molecular formula C26H40O8 and a molecular weight of 480.60 g/mol. Its IUPAC name is [(1R,2R,3E,7Z,9R)-6-acetyloxy-2-methoxy-9-(2-methoxyethoxymethoxy)-11,14,14-trimethyl-5-bicyclo[8.3.1]tetradeca-3,7,10-trienyl] acetate.
| Compound Name | [(1R,2R,3E,7Z,9R)-6-acetyloxy-2-methoxy-9-(2-methoxyethoxymethoxy)-11,14,14-trimethyl-5-bicyclo[8.3.1]tetradeca-3,7,10-trienyl] acetate |
|---|---|
| PubChem CID | 53325051 |
| Molecular Formula | C26H40O8 |
| Molecular Weight | 480.60 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | [(1R,2R,3E,7Z,9R)-6-acetyloxy-2-methoxy-9-(2-methoxyethoxymethoxy)-11,14,14-trimethyl-5-bicyclo[8.3.1]tetradeca-3,7,10-trienyl] acetate |
| SMILES | COCCOCO[C@@H]1/C=C\C(OC(C)=O)C(OC(C)=O)/C=C/[C@@H](OC)[C@@H]2CCC(C)=C1C2(C)C |
| InChI | InChI=1S/C26H40O8/c1-17-8-9-20-21(30-7)10-11-22(33-18(2)27)23(34-19(3)28)12-13-24(25(17)26(20,4)5)32-16-31-15-14-29-6/h10-13,20-24H,8-9,14-16H2,1-7H3/b11-10+,13-12-/t20-,21+,22?,23?,24+/m0/s1 |
| InChIKey | NQCBVOZPBRFMSA-XDTDIYPDSA-N |
| XLogP | 3.75 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|