C20H30O9 — CID 5363915
methyl (E)-4-[7-acetyloxy-3a-(2-acetyloxyethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-3-methylbut-2-enoate (PubChem CID 5363915) has the molecular formula C20H30O9 and a molecular weight of 414.45 g/mol. Its IUPAC name is methyl (E)-4-[7-acetyloxy-3a-(2-acetyloxyethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-3-methylbut-2-enoate.
| Compound Name | methyl (E)-4-[7-acetyloxy-3a-(2-acetyloxyethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 5363915 |
| Molecular Formula | C20H30O9 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.19 |
| IUPAC Name | methyl (E)-4-[7-acetyloxy-3a-(2-acetyloxyethyl)-2,2-dimethyl-4,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-6-yl]-3-methylbut-2-enoate |
| SMILES | COC(=O)/C=C(\C)CC1OCC2(CCOC(C)=O)OC(C)(C)OC2C1OC(C)=O |
| InChI | InChI=1S/C20H30O9/c1-12(10-16(23)24-6)9-15-17(27-14(3)22)18-20(11-26-15,7-8-25-13(2)21)29-19(4,5)28-18/h10,15,17-18H,7-9,11H2,1-6H3/b12-10+ |
| InChIKey | PLTAJOBATZYEIN-ZRDIBKRKSA-N |
| XLogP | 1.67 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|