C24H30O9 — CID 163046000
[(1R,2E,4R,11R,12R)-1-acetyloxy-7-(acetyloxymethyl)-2,11-dimethyl-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradeca-2,7-dien-12-yl] (E)-2-methylbut-2-enoate (PubChem CID 163046000) has the molecular formula C24H30O9 and a molecular weight of 462.50 g/mol. Its IUPAC name is [(1R,2E,4R,11R,12R)-1-acetyloxy-7-(acetyloxymethyl)-2,11-dimethyl-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradeca-2,7-dien-12-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,2E,4R,11R,12R)-1-acetyloxy-7-(acetyloxymethyl)-2,11-dimethyl-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradeca-2,7-dien-12-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163046000 |
| Molecular Formula | C24H30O9 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | [(1R,2E,4R,11R,12R)-1-acetyloxy-7-(acetyloxymethyl)-2,11-dimethyl-6-oxo-5,14-dioxatricyclo[9.2.1.04,8]tetradeca-2,7-dien-12-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1C[C@]2(OC(C)=O)O[C@]1(C)CCC1=C(COC(C)=O)C(=O)O[C@@H]1/C=C/2C |
| InChI | InChI=1S/C24H30O9/c1-7-13(2)21(27)31-20-11-24(32-16(5)26)14(3)10-19-17(8-9-23(20,6)33-24)18(22(28)30-19)12-29-15(4)25/h7,10,19-20H,8-9,11-12H2,1-6H3/b13-7+,14-10+/t19-,20-,23-,24+/m1/s1 |
| InChIKey | YJALUVZAAUZICK-ZEWDAKCDSA-N |
| XLogP | 2.83 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|