C28H40O9 — CID 11670855
[(1R,2S,3R,4R,7R,8R,11S,14R)-4,14-diacetyloxy-3-(2-acetyloxypropan-2-yl)-6,14-dimethyl-10-methylidene-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate (PubChem CID 11670855) has the molecular formula C28H40O9 and a molecular weight of 520.62 g/mol. Its IUPAC name is [(1R,2S,3R,4R,7R,8R,11S,14R)-4,14-diacetyloxy-3-(2-acetyloxypropan-2-yl)-6,14-dimethyl-10-methylidene-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate.
| Compound Name | [(1R,2S,3R,4R,7R,8R,11S,14R)-4,14-diacetyloxy-3-(2-acetyloxypropan-2-yl)-6,14-dimethyl-10-methylidene-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate |
|---|---|
| PubChem CID | 11670855 |
| Molecular Formula | C28H40O9 |
| Molecular Weight | 520.62 g/mol |
| Exact Mass | 520.27 |
| IUPAC Name | [(1R,2S,3R,4R,7R,8R,11S,14R)-4,14-diacetyloxy-3-(2-acetyloxypropan-2-yl)-6,14-dimethyl-10-methylidene-15-oxatricyclo[6.6.1.02,7]pentadec-5-en-11-yl] acetate |
| SMILES | C=C1C[C@H]2O[C@H]([C@H]3[C@@H]2C(C)=C[C@@H](OC(C)=O)[C@@H]3C(C)(C)OC(C)=O)[C@](C)(OC(C)=O)CC[C@@H]1OC(C)=O |
| InChI | InChI=1S/C28H40O9/c1-14-12-21-23-15(2)13-22(34-17(4)30)25(27(7,8)36-18(5)31)24(23)26(35-21)28(9,37-19(6)32)11-10-20(14)33-16(3)29/h13,20-26H,1,10-12H2,2-9H3/t20-,21+,22+,23+,24-,25-,26+,28+/m0/s1 |
| InChIKey | WOQOUHHNXXRZJE-DRSLJDJFSA-N |
| XLogP | 3.83 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.62 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|