C22H34O3 — CID 44566634
[(1S,2R,6R,7R,8S,9R,12E)-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-yl] acetate (PubChem CID 44566634) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is [(1S,2R,6R,7R,8S,9R,12E)-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-yl] acetate.
| Compound Name | [(1S,2R,6R,7R,8S,9R,12E)-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-yl] acetate |
|---|---|
| PubChem CID | 44566634 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | [(1S,2R,6R,7R,8S,9R,12E)-9,13-dimethyl-3-methylidene-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-12-en-9-yl] acetate |
| SMILES | C=C1CC[C@H](C(C)C)[C@@H]2[C@H]1[C@@H]1C/C(C)=C\CC[C@@](C)(OC(C)=O)[C@H]2O1 |
| InChI | InChI=1S/C22H34O3/c1-13(2)17-10-9-15(4)19-18-12-14(3)8-7-11-22(6,25-16(5)23)21(24-18)20(17)19/h8,13,17-21H,4,7,9-12H2,1-3,5-6H3/b14-8-/t17-,18+,19-,20-,21+,22-/m1/s1 |
| InChIKey | DEPBIQJKIVZYES-DMHBGFSHSA-N |
| XLogP | 5.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|