C22H36O4 — CID 134143020
[(1R,2S,5R,7S,10E,13S)-1,5,10-trimethyl-13-propan-2-yl-6,16-dioxatricyclo[11.2.1.05,7]hexadec-10-en-2-yl] acetate (PubChem CID 134143020) has the molecular formula C22H36O4 and a molecular weight of 364.53 g/mol. Its IUPAC name is [(1R,2S,5R,7S,10E,13S)-1,5,10-trimethyl-13-propan-2-yl-6,16-dioxatricyclo[11.2.1.05,7]hexadec-10-en-2-yl] acetate.
| Compound Name | [(1R,2S,5R,7S,10E,13S)-1,5,10-trimethyl-13-propan-2-yl-6,16-dioxatricyclo[11.2.1.05,7]hexadec-10-en-2-yl] acetate |
|---|---|
| PubChem CID | 134143020 |
| Molecular Formula | C22H36O4 |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.26 |
| IUPAC Name | [(1R,2S,5R,7S,10E,13S)-1,5,10-trimethyl-13-propan-2-yl-6,16-dioxatricyclo[11.2.1.05,7]hexadec-10-en-2-yl] acetate |
| SMILES | CC(=O)O[C@H]1CC[C@@]2(C)O[C@H]2CC/C(C)=C/C[C@]2(C(C)C)CC[C@@]1(C)O2 |
| InChI | InChI=1S/C22H36O4/c1-15(2)22-12-9-16(3)7-8-19-20(5,25-19)11-10-18(24-17(4)23)21(6,26-22)13-14-22/h9,15,18-19H,7-8,10-14H2,1-6H3/b16-9+/t18-,19-,20+,21+,22+/m0/s1 |
| InChIKey | QYKARXZAAXHOJT-BKBTXCQASA-N |
| XLogP | 4.95 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|