C29H50O3 — CID 134134277
[(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] nonanoate (PubChem CID 134134277) has the molecular formula C29H50O3 and a molecular weight of 446.72 g/mol. Its IUPAC name is [(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] nonanoate.
| Compound Name | [(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] nonanoate |
|---|---|
| PubChem CID | 134134277 |
| Molecular Formula | C29H50O3 |
| Molecular Weight | 446.72 g/mol |
| Exact Mass | 446.38 |
| IUPAC Name | [(1R,2S,5E,9E,12S)-1,5,9-trimethyl-12-propan-2-yl-15-oxabicyclo[10.2.1]pentadeca-5,9-dien-2-yl] nonanoate |
| SMILES | CCCCCCCCC(=O)O[C@H]1CC/C(C)=C/CC/C(C)=C/C[C@]2(C(C)C)CC[C@@]1(C)O2 |
| InChI | InChI=1S/C29H50O3/c1-7-8-9-10-11-12-16-27(30)31-26-18-17-24(4)14-13-15-25(5)19-20-29(23(2)3)22-21-28(26,6)32-29/h14,19,23,26H,7-13,15-18,20-22H2,1-6H3/b24-14+,25-19+/t26-,28+,29+/m0/s1 |
| InChIKey | RZMCRLYIPXLJDL-VABOSOLWSA-N |
| XLogP | 8.47 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.72 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|