C22H34O5 — CID 14866149
[(1R,2R,3R,4S,6E,10S)-2-acetyloxy-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-4-yl] 3-methylbut-2-enoate (PubChem CID 14866149) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is [(1R,2R,3R,4S,6E,10S)-2-acetyloxy-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-4-yl] 3-methylbut-2-enoate.
| Compound Name | [(1R,2R,3R,4S,6E,10S)-2-acetyloxy-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-4-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 14866149 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | [(1R,2R,3R,4S,6E,10S)-2-acetyloxy-6,10-dimethyl-3-propan-2-yl-11-oxabicyclo[8.1.0]undec-6-en-4-yl] 3-methylbut-2-enoate |
| SMILES | CC(=O)O[C@@H]1[C@H](C(C)C)[C@@H](OC(=O)C=C(C)C)C/C(C)=C/CC[C@]2(C)O[C@H]12 |
| InChI | InChI=1S/C22H34O5/c1-13(2)11-18(24)26-17-12-15(5)9-8-10-22(7)21(27-22)20(25-16(6)23)19(17)14(3)4/h9,11,14,17,19-21H,8,10,12H2,1-7H3/b15-9+/t17-,19+,20+,21+,22-/m0/s1 |
| InChIKey | CSDVZHYNOKGRFJ-BRTWAYQUSA-N |
| XLogP | 4.36 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|