C23H20F3NO2 — CID 134843457
1-[3-(trifluoromethyl)phenyl]prop-2-enyl N-[(1R)-1-naphthalen-1-ylethyl]carbamate (PubChem CID 134843457) has the molecular formula C23H20F3NO2 and a molecular weight of 399.41 g/mol. Its IUPAC name is 1-[3-(trifluoromethyl)phenyl]prop-2-enyl N-[(1R)-1-naphthalen-1-ylethyl]carbamate.
| Compound Name | 1-[3-(trifluoromethyl)phenyl]prop-2-enyl N-[(1R)-1-naphthalen-1-ylethyl]carbamate |
|---|---|
| PubChem CID | 134843457 |
| Molecular Formula | C23H20F3NO2 |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 1-[3-(trifluoromethyl)phenyl]prop-2-enyl N-[(1R)-1-naphthalen-1-ylethyl]carbamate |
| SMILES | C=CC(OC(=O)N[C@H](C)c1cccc2ccccc12)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H20F3NO2/c1-3-21(17-10-6-11-18(14-17)23(24,25)26)29-22(28)27-15(2)19-13-7-9-16-8-4-5-12-20(16)19/h3-15,21H,1H2,2H3,(H,27,28)/t15-,21?/m1/s1 |
| InChIKey | JWYDADZFLDXJEQ-RBFZIWAESA-N |
| XLogP | 6.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|