C22H22F3NO4S — CID 134843315
[3-[[(1R)-1-naphthalen-1-ylethyl]azaniumyl]-1-[3-(trifluoromethyl)phenyl]propyl] sulfate (PubChem CID 134843315) has the molecular formula C22H22F3NO4S and a molecular weight of 453.48 g/mol. Its IUPAC name is [3-[[(1R)-1-naphthalen-1-ylethyl]azaniumyl]-1-[3-(trifluoromethyl)phenyl]propyl] sulfate.
| Compound Name | [3-[[(1R)-1-naphthalen-1-ylethyl]azaniumyl]-1-[3-(trifluoromethyl)phenyl]propyl] sulfate |
|---|---|
| PubChem CID | 134843315 |
| Molecular Formula | C22H22F3NO4S |
| Molecular Weight | 453.48 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | [3-[[(1R)-1-naphthalen-1-ylethyl]azaniumyl]-1-[3-(trifluoromethyl)phenyl]propyl] sulfate |
| SMILES | C[C@@H]([NH2+]CCC(OS(=O)(=O)[O-])c1cccc(C(F)(F)F)c1)c1cccc2ccccc12 |
| InChI | InChI=1S/C22H22F3NO4S/c1-15(19-11-5-7-16-6-2-3-10-20(16)19)26-13-12-21(30-31(27,28)29)17-8-4-9-18(14-17)22(23,24)25/h2-11,14-15,21,26H,12-13H2,1H3,(H,27,28,29)/t15-,21?/m1/s1 |
| InChIKey | COQVRHNBLHYXHS-RBFZIWAESA-N |
| XLogP | 4.09 |
| TPSA | 83.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.48 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|