About benzene;bromocopper;carbanide
benzene;bromocopper;carbanide (PubChem CID 134843479) has the molecular formula C7H8BrCu-2
and a molecular weight of 235.59 g/mol. Its IUPAC name is benzene;bromocopper;carbanide.
Molecular Properties
| Compound Name | benzene;bromocopper;carbanide |
| PubChem CID | 134843479 |
| Molecular Formula | C7H8BrCu-2 |
| Molecular Weight | 235.59 g/mol |
| Exact Mass | 233.91 |
| IUPAC Name | benzene;bromocopper;carbanide |
| SMILES | [CH3-].[Cu]Br.[c-]1ccccc1 |
| InChI | InChI=1S/C6H5.CH3.BrH.Cu/c1-2-4-6-5-3-1;;;/h1-5H;1H3;1H;/q2*-1;;+1/p-1 |
| InChIKey | HNUFKTKKKPNVQY-UHFFFAOYSA-M |
| XLogP | 2.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.59 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;bromocopper;carbanide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;bromocopper;carbanide?
The IUPAC name of benzene;bromocopper;carbanide (CID 134843479) is benzene;bromocopper;carbanide.
What is the SMILES notation for benzene;bromocopper;carbanide?
The canonical SMILES for benzene;bromocopper;carbanide is [CH3-].[Cu]Br.[c-]1ccccc1.
What is the InChIKey of benzene;bromocopper;carbanide?
The InChIKey is HNUFKTKKKPNVQY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H5.CH3.BrH.Cu/c1-2-4-6-5-3-1;;;/h1-5H;1H3;1H;/q2*-1;;+1/p-1.
What are the key properties of benzene;bromocopper;carbanide?
benzene;bromocopper;carbanide has a molecular weight of 235.59 g/mol, XLogP of 2.78, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;bromocopper;carbanide is sourced from PubChem (CID 134843479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).