C18H19Cl4NO8 — CID 134844165
2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetate (PubChem CID 134844165) has the molecular formula C18H19Cl4NO8 and a molecular weight of 519.16 g/mol. Its IUPAC name is 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetate.
| Compound Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetate |
|---|---|
| PubChem CID | 134844165 |
| Molecular Formula | C18H19Cl4NO8 |
| Molecular Weight | 519.16 g/mol |
| Exact Mass | 516.99 |
| IUPAC Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl 2-(4,5,6,7-tetrachloro-1,3-dioxoisoindol-2-yl)acetate |
| SMILES | O=C(CN1C(=O)c2c(Cl)c(Cl)c(Cl)c(Cl)c2C1=O)OCCOCCOCCOCCO |
| InChI | InChI=1S/C18H19Cl4NO8/c19-13-11-12(14(20)16(22)15(13)21)18(27)23(17(11)26)9-10(25)31-8-7-30-6-5-29-4-3-28-2-1-24/h24H,1-9H2 |
| InChIKey | MKXVDTDGPIJOCP-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.16 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|