C18H15ClN2O5S — CID 134844569
[2-chloro-3-(4-methylphenyl)sulfonyl-4-oxoquinazolin-8-yl]methyl acetate (PubChem CID 134844569) has the molecular formula C18H15ClN2O5S and a molecular weight of 406.85 g/mol. Its IUPAC name is [2-chloro-3-(4-methylphenyl)sulfonyl-4-oxoquinazolin-8-yl]methyl acetate.
| Compound Name | [2-chloro-3-(4-methylphenyl)sulfonyl-4-oxoquinazolin-8-yl]methyl acetate |
|---|---|
| PubChem CID | 134844569 |
| Molecular Formula | C18H15ClN2O5S |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | [2-chloro-3-(4-methylphenyl)sulfonyl-4-oxoquinazolin-8-yl]methyl acetate |
| SMILES | CC(=O)OCc1cccc2c(=O)n(S(=O)(=O)c3ccc(C)cc3)c(Cl)nc12 |
| InChI | InChI=1S/C18H15ClN2O5S/c1-11-6-8-14(9-7-11)27(24,25)21-17(23)15-5-3-4-13(10-26-12(2)22)16(15)20-18(21)19/h3-9H,10H2,1-2H3 |
| InChIKey | OJTFDIGFIYGNQW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 95.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |