About 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium
1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium (PubChem CID 134844587) has the molecular formula C9H8IRf-
and a molecular weight of 510.07 g/mol. Its IUPAC name is 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium.
Molecular Properties
| Compound Name | 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium |
| PubChem CID | 134844587 |
| Molecular Formula | C9H8IRf- |
| Molecular Weight | 510.07 g/mol |
| Exact Mass | 510.09 |
| IUPAC Name | 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium |
| SMILES | C=CCc1ccc[c-]c1I.[Rf] |
| InChI | InChI=1S/C9H8I.Rf/c1-2-5-8-6-3-4-7-9(8)10;/h2-4,6H,1,5H2;/q-1; |
| InChIKey | PUOZARZKYALEPI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 510.07 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium?
The IUPAC name of 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium (CID 134844587) is 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium.
What is the SMILES notation for 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium?
The canonical SMILES for 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium is C=CCc1ccc[c-]c1I.[Rf].
What is the InChIKey of 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium?
The InChIKey is PUOZARZKYALEPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8I.Rf/c1-2-5-8-6-3-4-7-9(8)10;/h2-4,6H,1,5H2;/q-1;.
What are the key properties of 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium?
1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium has a molecular weight of 510.07 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-iodo-2-prop-2-enylbenzene-6-ide;rutherfordium is sourced from PubChem (CID 134844587), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).