C21H29- — CID 134844623
CID 134844623 (PubChem CID 134844623) has the molecular formula C21H29- and a molecular weight of 281.46 g/mol.
| Compound Name | CID 134844623 |
|---|---|
| PubChem CID | 134844623 |
| Molecular Formula | C21H29- |
| Molecular Weight | 281.46 g/mol |
| Exact Mass | 281.23 |
| IUPAC Name | — |
| SMILES | CC12CCC(c3c1cc1[c-]3C3CCC1(C)C3(C)C)C2(C)C |
| InChI | InChI=1S/C21H29/c1-18(2)12-7-9-20(18,5)14-11-15-17(16(12)14)13-8-10-21(15,6)19(13,3)4/h11-13H,7-10H2,1-6H3/q-1 |
| InChIKey | YQRHTXGCWQNTES-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.46 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|