C34H37NO4 — CID 134844643
(5R)-1-benzyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-3-ol (PubChem CID 134844643) has the molecular formula C34H37NO4 and a molecular weight of 523.67 g/mol. Its IUPAC name is (5R)-1-benzyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-3-ol.
| Compound Name | (5R)-1-benzyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-3-ol |
|---|---|
| PubChem CID | 134844643 |
| Molecular Formula | C34H37NO4 |
| Molecular Weight | 523.67 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | (5R)-1-benzyl-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)piperidin-3-ol |
| SMILES | OC1CN(Cc2ccccc2)C(COCc2ccccc2)[C@@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C34H37NO4/c36-32-22-35(21-27-13-5-1-6-14-27)31(26-37-23-28-15-7-2-8-16-28)33(38-24-29-17-9-3-10-18-29)34(32)39-25-30-19-11-4-12-20-30/h1-20,31-34,36H,21-26H2/t31?,32?,33-,34?/m1/s1 |
| InChIKey | XIBNBWHRAXBUMB-IZBKTERLSA-N |
| XLogP | 5.62 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.67 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |