C28H45NO2Si — CID 134845058
(3S)-3-[4-[tert-butyl(diphenyl)silyl]oxybutylamino]octan-1-ol (PubChem CID 134845058) has the molecular formula C28H45NO2Si and a molecular weight of 455.76 g/mol. Its IUPAC name is (3S)-3-[4-[tert-butyl(diphenyl)silyl]oxybutylamino]octan-1-ol.
| Compound Name | (3S)-3-[4-[tert-butyl(diphenyl)silyl]oxybutylamino]octan-1-ol |
|---|---|
| PubChem CID | 134845058 |
| Molecular Formula | C28H45NO2Si |
| Molecular Weight | 455.76 g/mol |
| Exact Mass | 455.32 |
| IUPAC Name | (3S)-3-[4-[tert-butyl(diphenyl)silyl]oxybutylamino]octan-1-ol |
| SMILES | CCCCC[C@@H](CCO)NCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H45NO2Si/c1-5-6-9-16-25(21-23-30)29-22-14-15-24-31-32(28(2,3)4,26-17-10-7-11-18-26)27-19-12-8-13-20-27/h7-8,10-13,17-20,25,29-30H,5-6,9,14-16,21-24H2,1-4H3/t25-/m0/s1 |
| InChIKey | UGCOJASJCUAQNG-VWLOTQADSA-N |
| XLogP | 5.26 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.76 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|