C18H28O6 — CID 134845234
(3aR,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-prop-2-enoxy-6-prop-2-enyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole (PubChem CID 134845234) has the molecular formula C18H28O6 and a molecular weight of 340.42 g/mol. Its IUPAC name is (3aR,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-prop-2-enoxy-6-prop-2-enyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole.
| Compound Name | (3aR,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-prop-2-enoxy-6-prop-2-enyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 134845234 |
| Molecular Formula | C18H28O6 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (3aR,6R,6aR)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-6-prop-2-enoxy-6-prop-2-enyl-5,6a-dihydro-3aH-furo[2,3-d][1,3]dioxole |
| SMILES | C=CCO[C@]1(CC=C)C([C@H]2COC(C)(C)O2)O[C@@H]2OC(C)(C)O[C@@H]21 |
| InChI | InChI=1S/C18H28O6/c1-7-9-18(19-10-8-2)13(12-11-20-16(3,4)22-12)21-15-14(18)23-17(5,6)24-15/h7-8,12-15H,1-2,9-11H2,3-6H3/t12-,13?,14+,15-,18-/m1/s1 |
| InChIKey | AHPYRQKFGZWZEF-COJFQYDSSA-N |
| XLogP | 2.53 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|