C25H25FO7 — CID 134846394
trimethyl (2R,3R,4S)-4-[2-(4-fluorophenyl)-2-oxoethyl]-2-phenylcyclopentane-1,1,3-tricarboxylate (PubChem CID 134846394) has the molecular formula C25H25FO7 and a molecular weight of 456.47 g/mol. Its IUPAC name is trimethyl (2R,3R,4S)-4-[2-(4-fluorophenyl)-2-oxoethyl]-2-phenylcyclopentane-1,1,3-tricarboxylate.
| Compound Name | trimethyl (2R,3R,4S)-4-[2-(4-fluorophenyl)-2-oxoethyl]-2-phenylcyclopentane-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 134846394 |
| Molecular Formula | C25H25FO7 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | trimethyl (2R,3R,4S)-4-[2-(4-fluorophenyl)-2-oxoethyl]-2-phenylcyclopentane-1,1,3-tricarboxylate |
| SMILES | COC(=O)[C@@H]1[C@H](CC(=O)c2ccc(F)cc2)CC(C(=O)OC)(C(=O)OC)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C25H25FO7/c1-31-22(28)20-17(13-19(27)15-9-11-18(26)12-10-15)14-25(23(29)32-2,24(30)33-3)21(20)16-7-5-4-6-8-16/h4-12,17,20-21H,13-14H2,1-3H3/t17-,20-,21+/m1/s1 |
| InChIKey | UMCOUYVVPFTOQV-UIFIKXQLSA-N |
| XLogP | 3.32 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|