C20H24N2O3 — CID 134847227
[(E)-1-[2-(4-methoxyphenyl)phenyl]ethylideneamino] N,N-diethylcarbamate (PubChem CID 134847227) has the molecular formula C20H24N2O3 and a molecular weight of 340.42 g/mol. Its IUPAC name is [(E)-1-[2-(4-methoxyphenyl)phenyl]ethylideneamino] N,N-diethylcarbamate.
| Compound Name | [(E)-1-[2-(4-methoxyphenyl)phenyl]ethylideneamino] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 134847227 |
| Molecular Formula | C20H24N2O3 |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | [(E)-1-[2-(4-methoxyphenyl)phenyl]ethylideneamino] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)O/N=C(\C)c1ccccc1-c1ccc(OC)cc1 |
| InChI | InChI=1S/C20H24N2O3/c1-5-22(6-2)20(23)25-21-15(3)18-9-7-8-10-19(18)16-11-13-17(24-4)14-12-16/h7-14H,5-6H2,1-4H3/b21-15+ |
| InChIKey | QESHNCWHNMRUCO-RCCKNPSSSA-N |
| XLogP | 4.56 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|