C48H52O10 — CID 134847324
(4aR,8S,8aR)-6-methoxy-4',5',7,8-tetrakis(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2,2'-oxane] (PubChem CID 134847324) has the molecular formula C48H52O10 and a molecular weight of 788.93 g/mol. Its IUPAC name is (4aR,8S,8aR)-6-methoxy-4',5',7,8-tetrakis(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2,2'-oxane].
| Compound Name | (4aR,8S,8aR)-6-methoxy-4',5',7,8-tetrakis(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2,2'-oxane] |
|---|---|
| PubChem CID | 134847324 |
| Molecular Formula | C48H52O10 |
| Molecular Weight | 788.93 g/mol |
| Exact Mass | 788.36 |
| IUPAC Name | (4aR,8S,8aR)-6-methoxy-4',5',7,8-tetrakis(phenylmethoxy)-6'-(phenylmethoxymethyl)spiro[4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxine-2,2'-oxane] |
| SMILES | COC1O[C@@H]2COC3(CC(OCc4ccccc4)C(OCc4ccccc4)C(COCc4ccccc4)O3)O[C@H]2[C@H](OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C48H52O10/c1-49-47-46(54-32-39-25-15-6-16-26-39)45(53-31-38-23-13-5-14-24-38)44-41(56-47)34-55-48(58-44)27-40(51-29-36-19-9-3-10-20-36)43(52-30-37-21-11-4-12-22-37)42(57-48)33-50-28-35-17-7-2-8-18-35/h2-26,40-47H,27-34H2,1H3/t40?,41-,42?,43?,44-,45+,46?,47?,48?/m1/s1 |
| InChIKey | LVLQAYFPVXNWQT-HFPCTJFPSA-N |
| XLogP | 7.77 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 788.93 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |