C30H62O2Si4Sn — CID 134847798
[(E)-2-(4-methoxyphenoxy)-2-tributylstannylethenyl]-tris(trimethylsilyl)silane (PubChem CID 134847798) has the molecular formula C30H62O2Si4Sn and a molecular weight of 685.88 g/mol. Its IUPAC name is [(E)-2-(4-methoxyphenoxy)-2-tributylstannylethenyl]-tris(trimethylsilyl)silane.
| Compound Name | [(E)-2-(4-methoxyphenoxy)-2-tributylstannylethenyl]-tris(trimethylsilyl)silane |
|---|---|
| PubChem CID | 134847798 |
| Molecular Formula | C30H62O2Si4Sn |
| Molecular Weight | 685.88 g/mol |
| Exact Mass | 686.28 |
| IUPAC Name | [(E)-2-(4-methoxyphenoxy)-2-tributylstannylethenyl]-tris(trimethylsilyl)silane |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)Oc1ccc(OC)cc1 |
| InChI | InChI=1S/C18H35O2Si4.3C4H9.Sn/c1-19-17-11-13-18(14-12-17)20-15-16-24(21(2,3)4,22(5,6)7)23(8,9)10;3*1-3-4-2;/h11-14,16H,1-10H3;3*1,3-4H2,2H3; |
| InChIKey | OZHWDPGOMGWUDD-UHFFFAOYSA-N |
| XLogP | 10.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.88 |
| LogP ≤ 5 | 10.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|