C20H21F3O5 — CID 134847906
5,5-dimethyl-3-oxo-2-[(1R,2S)-4,4,4-trifluoro-2-methoxycarbonyl-3-oxoniumylidene-1-phenylbutyl]cyclohexen-1-olate (PubChem CID 134847906) has the molecular formula C20H21F3O5 and a molecular weight of 398.38 g/mol. Its IUPAC name is 5,5-dimethyl-3-oxo-2-[(1R,2S)-4,4,4-trifluoro-2-methoxycarbonyl-3-oxoniumylidene-1-phenylbutyl]cyclohexen-1-olate.
| Compound Name | 5,5-dimethyl-3-oxo-2-[(1R,2S)-4,4,4-trifluoro-2-methoxycarbonyl-3-oxoniumylidene-1-phenylbutyl]cyclohexen-1-olate |
|---|---|
| PubChem CID | 134847906 |
| Molecular Formula | C20H21F3O5 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | 5,5-dimethyl-3-oxo-2-[(1R,2S)-4,4,4-trifluoro-2-methoxycarbonyl-3-oxoniumylidene-1-phenylbutyl]cyclohexen-1-olate |
| SMILES | [H]/[O+]=C(/[C@@H](C(=O)OC)[C@@H](C1=C([O-])CC(C)(C)CC1=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H21F3O5/c1-19(2)9-12(24)15(13(25)10-19)14(11-7-5-4-6-8-11)16(18(27)28-3)17(26)20(21,22)23/h4-8,14,16,24H,9-10H2,1-3H3/t14-,16+/m1/s1 |
| InChIKey | VGKGCOINBWQYRX-ZBFHGGJFSA-N |
| XLogP | 2.67 |
| TPSA | 87.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|