C31H43F3O4 — CID 66691431
3,5-dihydroxy-4,6,6-tris(3-methylbutyl)-2-[3-[4-(trifluoromethyl)phenyl]propanoyl]cyclohexa-2,4-dien-1-one (PubChem CID 66691431) has the molecular formula C31H43F3O4 and a molecular weight of 536.68 g/mol. Its IUPAC name is 3,5-dihydroxy-4,6,6-tris(3-methylbutyl)-2-[3-[4-(trifluoromethyl)phenyl]propanoyl]cyclohexa-2,4-dien-1-one.
| Compound Name | 3,5-dihydroxy-4,6,6-tris(3-methylbutyl)-2-[3-[4-(trifluoromethyl)phenyl]propanoyl]cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 66691431 |
| Molecular Formula | C31H43F3O4 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.31 |
| IUPAC Name | 3,5-dihydroxy-4,6,6-tris(3-methylbutyl)-2-[3-[4-(trifluoromethyl)phenyl]propanoyl]cyclohexa-2,4-dien-1-one |
| SMILES | CC(C)CCC1=C(O)C(CCC(C)C)(CCC(C)C)C(=O)C(C(=O)CCc2ccc(C(F)(F)F)cc2)=C1O |
| InChI | InChI=1S/C31H43F3O4/c1-19(2)7-13-24-27(36)26(25(35)14-10-22-8-11-23(12-9-22)31(32,33)34)29(38)30(28(24)37,17-15-20(3)4)18-16-21(5)6/h8-9,11-12,19-21,36-37H,7,10,13-18H2,1-6H3 |
| InChIKey | QIKBWEPWIZQIPO-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|