C25H32O4 — CID 16736813
3-hydroxy-5-methoxy-2-[(E)-3-phenylprop-2-enoyl]-4,6,6-tripropylcyclohexa-2,4-dien-1-one (PubChem CID 16736813) has the molecular formula C25H32O4 and a molecular weight of 396.53 g/mol. Its IUPAC name is 3-hydroxy-5-methoxy-2-[(E)-3-phenylprop-2-enoyl]-4,6,6-tripropylcyclohexa-2,4-dien-1-one.
| Compound Name | 3-hydroxy-5-methoxy-2-[(E)-3-phenylprop-2-enoyl]-4,6,6-tripropylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 16736813 |
| Molecular Formula | C25H32O4 |
| Molecular Weight | 396.53 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | 3-hydroxy-5-methoxy-2-[(E)-3-phenylprop-2-enoyl]-4,6,6-tripropylcyclohexa-2,4-dien-1-one |
| SMILES | CCCC1=C(OC)C(CCC)(CCC)C(=O)C(C(=O)/C=C/c2ccccc2)=C1O |
| InChI | InChI=1S/C25H32O4/c1-5-11-19-22(27)21(20(26)15-14-18-12-9-8-10-13-18)23(28)25(16-6-2,17-7-3)24(19)29-4/h8-10,12-15,27H,5-7,11,16-17H2,1-4H3/b15-14+ |
| InChIKey | CYSLIUQOTXKRRJ-CCEZHUSRSA-N |
| XLogP | 5.95 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|