C27H36O4 — CID 51351527
3-hydroxy-2-[(E)-3-phenylprop-2-enoyl]-5-propoxy-4,6,6-tripropylcyclohexa-2,4-dien-1-one (PubChem CID 51351527) has the molecular formula C27H36O4 and a molecular weight of 424.58 g/mol. Its IUPAC name is 3-hydroxy-2-[(E)-3-phenylprop-2-enoyl]-5-propoxy-4,6,6-tripropylcyclohexa-2,4-dien-1-one.
| Compound Name | 3-hydroxy-2-[(E)-3-phenylprop-2-enoyl]-5-propoxy-4,6,6-tripropylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 51351527 |
| Molecular Formula | C27H36O4 |
| Molecular Weight | 424.58 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 3-hydroxy-2-[(E)-3-phenylprop-2-enoyl]-5-propoxy-4,6,6-tripropylcyclohexa-2,4-dien-1-one |
| SMILES | CCCOC1=C(CCC)C(O)=C(C(=O)/C=C/c2ccccc2)C(=O)C1(CCC)CCC |
| InChI | InChI=1S/C27H36O4/c1-5-12-21-24(29)23(22(28)16-15-20-13-10-9-11-14-20)25(30)27(17-6-2,18-7-3)26(21)31-19-8-4/h9-11,13-16,29H,5-8,12,17-19H2,1-4H3/b16-15+ |
| InChIKey | XLQTZDORJULTII-FOCLMDBBSA-N |
| XLogP | 6.73 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.58 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|