C13H22F3I — CID 134847934
(Z)-1,1,1-trifluoro-2-iodotridec-2-ene (PubChem CID 134847934) has the molecular formula C13H22F3I and a molecular weight of 362.22 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-2-iodotridec-2-ene.
| Compound Name | (Z)-1,1,1-trifluoro-2-iodotridec-2-ene |
|---|---|
| PubChem CID | 134847934 |
| Molecular Formula | C13H22F3I |
| Molecular Weight | 362.22 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (Z)-1,1,1-trifluoro-2-iodotridec-2-ene |
| SMILES | CCCCCCCCCC/C=C(\I)C(F)(F)F |
| InChI | InChI=1S/C13H22F3I/c1-2-3-4-5-6-7-8-9-10-11-12(17)13(14,15)16/h11H,2-10H2,1H3/b12-11- |
| InChIKey | KIUYXJWMLROTES-QXMHVHEDSA-N |
| XLogP | 6.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.22 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|