C18H16O — CID 134847958
(2'S)-2'-ethenylspiro[fluorene-9,4'-oxolane] (PubChem CID 134847958) has the molecular formula C18H16O and a molecular weight of 248.33 g/mol. Its IUPAC name is (2'S)-2'-ethenylspiro[fluorene-9,4'-oxolane].
| Compound Name | (2'S)-2'-ethenylspiro[fluorene-9,4'-oxolane] |
|---|---|
| PubChem CID | 134847958 |
| Molecular Formula | C18H16O |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | (2'S)-2'-ethenylspiro[fluorene-9,4'-oxolane] |
| SMILES | C=C[C@@H]1CC2(CO1)c1ccccc1-c1ccccc12 |
| InChI | InChI=1S/C18H16O/c1-2-13-11-18(12-19-13)16-9-5-3-7-14(16)15-8-4-6-10-17(15)18/h2-10,13H,1,11-12H2/t13-/m1/s1 |
| InChIKey | LCWKJDVOXUAWNW-CYBMUJFWSA-N |
| XLogP | 3.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|