C19H37F3Si — CID 134847961
triethyl-[(E)-1,1,1-trifluorotridec-2-en-3-yl]silane (PubChem CID 134847961) has the molecular formula C19H37F3Si and a molecular weight of 350.59 g/mol. Its IUPAC name is triethyl-[(E)-1,1,1-trifluorotridec-2-en-3-yl]silane.
| Compound Name | triethyl-[(E)-1,1,1-trifluorotridec-2-en-3-yl]silane |
|---|---|
| PubChem CID | 134847961 |
| Molecular Formula | C19H37F3Si |
| Molecular Weight | 350.59 g/mol |
| Exact Mass | 350.26 |
| IUPAC Name | triethyl-[(E)-1,1,1-trifluorotridec-2-en-3-yl]silane |
| SMILES | CCCCCCCCCC/C(=C\C(F)(F)F)[Si](CC)(CC)CC |
| InChI | InChI=1S/C19H37F3Si/c1-5-9-10-11-12-13-14-15-16-18(17-19(20,21)22)23(6-2,7-3)8-4/h17H,5-16H2,1-4H3/b18-17+ |
| InChIKey | ZLNYROZYQNGNRU-ISLYRVAYSA-N |
| XLogP | 8.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.59 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|