C13H13N7O3 — CID 134848387
5-[C-(hydrazinecarbonyl)-N-hydroxycarbonimidoyl]-2-phenylpyrimidine-4-carbohydrazide (PubChem CID 134848387) has the molecular formula C13H13N7O3 and a molecular weight of 315.29 g/mol. Its IUPAC name is 5-[C-(hydrazinecarbonyl)-N-hydroxycarbonimidoyl]-2-phenylpyrimidine-4-carbohydrazide.
| Compound Name | 5-[C-(hydrazinecarbonyl)-N-hydroxycarbonimidoyl]-2-phenylpyrimidine-4-carbohydrazide |
|---|---|
| PubChem CID | 134848387 |
| Molecular Formula | C13H13N7O3 |
| Molecular Weight | 315.29 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | 5-[C-(hydrazinecarbonyl)-N-hydroxycarbonimidoyl]-2-phenylpyrimidine-4-carbohydrazide |
| SMILES | NNC(=O)C(=NO)c1cnc(-c2ccccc2)nc1C(=O)NN |
| InChI | InChI=1S/C13H13N7O3/c14-18-12(21)9-8(10(20-23)13(22)19-15)6-16-11(17-9)7-4-2-1-3-5-7/h1-6,23H,14-15H2,(H,18,21)(H,19,22) |
| InChIKey | DXNVJCATFHCXTC-UHFFFAOYSA-N |
| XLogP | -1.08 |
| TPSA | 168.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.29 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|