C37H38N2O10 — CID 134848904
(1R,2S)-1-(3,4-dihydroxy-5-methoxyphenyl)-7-hydroxy-2-N,3-N-bis[2-(4-hydroxyphenyl)ethyl]-6,8-dimethoxy-1,2-dihydronaphthalene-2,3-dicarboxamide (PubChem CID 134848904) has the molecular formula C37H38N2O10 and a molecular weight of 670.72 g/mol. Its IUPAC name is (1R,2S)-1-(3,4-dihydroxy-5-methoxyphenyl)-7-hydroxy-2-N,3-N-bis[2-(4-hydroxyphenyl)ethyl]-6,8-dimethoxy-1,2-dihydronaphthalene-2,3-dicarboxamide.
| Compound Name | (1R,2S)-1-(3,4-dihydroxy-5-methoxyphenyl)-7-hydroxy-2-N,3-N-bis[2-(4-hydroxyphenyl)ethyl]-6,8-dimethoxy-1,2-dihydronaphthalene-2,3-dicarboxamide |
|---|---|
| PubChem CID | 134848904 |
| Molecular Formula | C37H38N2O10 |
| Molecular Weight | 670.72 g/mol |
| Exact Mass | 670.25 |
| IUPAC Name | (1R,2S)-1-(3,4-dihydroxy-5-methoxyphenyl)-7-hydroxy-2-N,3-N-bis[2-(4-hydroxyphenyl)ethyl]-6,8-dimethoxy-1,2-dihydronaphthalene-2,3-dicarboxamide |
| SMILES | COc1cc([C@@H]2c3c(cc(OC)c(O)c3OC)C=C(C(=O)NCCc3ccc(O)cc3)[C@H]2C(=O)NCCc2ccc(O)cc2)cc(O)c1O |
| InChI | InChI=1S/C37H38N2O10/c1-47-28-19-23(17-27(42)33(28)43)30-31-22(18-29(48-2)34(44)35(31)49-3)16-26(36(45)38-14-12-20-4-8-24(40)9-5-20)32(30)37(46)39-15-13-21-6-10-25(41)11-7-21/h4-11,16-19,30,32,40-44H,12-15H2,1-3H3,(H,38,45)(H,39,46)/t30-,32-/m1/s1 |
| InChIKey | CAGNDBSGFYOPBD-XLJNKUFUSA-N |
| XLogP | 4.10 |
| TPSA | 187.04 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.72 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|