C19H17NO6 — CID 118708727
7-hydroxy-N-[2-(4-hydroxyphenyl)ethyl]-6-methoxy-2-oxochromene-3-carboxamide (PubChem CID 118708727) has the molecular formula C19H17NO6 and a molecular weight of 355.35 g/mol. Its IUPAC name is 7-hydroxy-N-[2-(4-hydroxyphenyl)ethyl]-6-methoxy-2-oxochromene-3-carboxamide.
| Compound Name | 7-hydroxy-N-[2-(4-hydroxyphenyl)ethyl]-6-methoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 118708727 |
| Molecular Formula | C19H17NO6 |
| Molecular Weight | 355.35 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | 7-hydroxy-N-[2-(4-hydroxyphenyl)ethyl]-6-methoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1cc2cc(C(=O)NCCc3ccc(O)cc3)c(=O)oc2cc1O |
| InChI | InChI=1S/C19H17NO6/c1-25-17-9-12-8-14(19(24)26-16(12)10-15(17)22)18(23)20-7-6-11-2-4-13(21)5-3-11/h2-5,8-10,21-22H,6-7H2,1H3,(H,20,23) |
| InChIKey | LLXHBBVDYRMRQX-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.35 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|