C22H24N2O5 — CID 71508315
N-[2-[benzyl(methyl)amino]ethyl]-6,7-dimethoxy-2-oxochromene-3-carboxamide (PubChem CID 71508315) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is N-[2-[benzyl(methyl)amino]ethyl]-6,7-dimethoxy-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-[benzyl(methyl)amino]ethyl]-6,7-dimethoxy-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 71508315 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | N-[2-[benzyl(methyl)amino]ethyl]-6,7-dimethoxy-2-oxochromene-3-carboxamide |
| SMILES | COc1cc2cc(C(=O)NCCN(C)Cc3ccccc3)c(=O)oc2cc1OC |
| InChI | InChI=1S/C22H24N2O5/c1-24(14-15-7-5-4-6-8-15)10-9-23-21(25)17-11-16-12-19(27-2)20(28-3)13-18(16)29-22(17)26/h4-8,11-13H,9-10,14H2,1-3H3,(H,23,25) |
| InChIKey | BWVRJRITHBXUPV-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|