C30H33N3O5 — CID 118711809
6,7-dimethoxy-2-oxo-N-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentyl]chromene-3-carboxamide (PubChem CID 118711809) has the molecular formula C30H33N3O5 and a molecular weight of 515.61 g/mol. Its IUPAC name is 6,7-dimethoxy-2-oxo-N-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentyl]chromene-3-carboxamide.
| Compound Name | 6,7-dimethoxy-2-oxo-N-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 118711809 |
| Molecular Formula | C30H33N3O5 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.24 |
| IUPAC Name | 6,7-dimethoxy-2-oxo-N-[5-(1,2,3,4-tetrahydroacridin-9-ylamino)pentyl]chromene-3-carboxamide |
| SMILES | COc1cc2cc(C(=O)NCCCCCNc3c4c(nc5ccccc35)CCCC4)c(=O)oc2cc1OC |
| InChI | InChI=1S/C30H33N3O5/c1-36-26-17-19-16-22(30(35)38-25(19)18-27(26)37-2)29(34)32-15-9-3-8-14-31-28-20-10-4-6-12-23(20)33-24-13-7-5-11-21(24)28/h4,6,10,12,16-18H,3,5,7-9,11,13-15H2,1-2H3,(H,31,33)(H,32,34) |
| InChIKey | WQAOCFQOQDPKHB-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|