C28H33N3O3Se — CID 72724703
5,6-dimethoxy-2-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-1,2-benzoselenazol-3-one (PubChem CID 72724703) has the molecular formula C28H33N3O3Se and a molecular weight of 538.55 g/mol. Its IUPAC name is 5,6-dimethoxy-2-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-1,2-benzoselenazol-3-one.
| Compound Name | 5,6-dimethoxy-2-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-1,2-benzoselenazol-3-one |
|---|---|
| PubChem CID | 72724703 |
| Molecular Formula | C28H33N3O3Se |
| Molecular Weight | 538.55 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 5,6-dimethoxy-2-[6-(1,2,3,4-tetrahydroacridin-9-ylamino)hexyl]-1,2-benzoselenazol-3-one |
| SMILES | COc1cc2[se]n(CCCCCCNc3c4c(nc5ccccc35)CCCC4)c(=O)c2cc1OC |
| InChI | InChI=1S/C28H33N3O3Se/c1-33-24-17-21-26(18-25(24)34-2)35-31(28(21)32)16-10-4-3-9-15-29-27-19-11-5-7-13-22(19)30-23-14-8-6-12-20(23)27/h5,7,11,13,17-18H,3-4,6,8-10,12,14-16H2,1-2H3,(H,29,30) |
| InChIKey | BGIOOSDXZCNZQT-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.55 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|