C32H37N3O5 — CID 118712172
6,7-dimethoxy-2-oxo-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]chromene-3-carboxamide (PubChem CID 118712172) has the molecular formula C32H37N3O5 and a molecular weight of 543.66 g/mol. Its IUPAC name is 6,7-dimethoxy-2-oxo-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]chromene-3-carboxamide.
| Compound Name | 6,7-dimethoxy-2-oxo-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 118712172 |
| Molecular Formula | C32H37N3O5 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | 6,7-dimethoxy-2-oxo-N-[7-(1,2,3,4-tetrahydroacridin-9-ylamino)heptyl]chromene-3-carboxamide |
| SMILES | COc1cc2cc(C(=O)NCCCCCCCNc3c4c(nc5ccccc35)CCCC4)c(=O)oc2cc1OC |
| InChI | InChI=1S/C32H37N3O5/c1-38-28-19-21-18-24(32(37)40-27(21)20-29(28)39-2)31(36)34-17-11-5-3-4-10-16-33-30-22-12-6-8-14-25(22)35-26-15-9-7-13-23(26)30/h6,8,12,14,18-20H,3-5,7,9-11,13,15-17H2,1-2H3,(H,33,35)(H,34,36) |
| InChIKey | HRGZWMLUBWDBQP-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 102.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|