C19H21FS — CID 134849357
1-[(R)-cyclohexylsulfanyl(phenyl)methyl]-4-fluorobenzene (PubChem CID 134849357) has the molecular formula C19H21FS and a molecular weight of 300.44 g/mol. Its IUPAC name is 1-[(R)-cyclohexylsulfanyl(phenyl)methyl]-4-fluorobenzene.
| Compound Name | 1-[(R)-cyclohexylsulfanyl(phenyl)methyl]-4-fluorobenzene |
|---|---|
| PubChem CID | 134849357 |
| Molecular Formula | C19H21FS |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 1-[(R)-cyclohexylsulfanyl(phenyl)methyl]-4-fluorobenzene |
| SMILES | Fc1ccc([C@H](SC2CCCCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H21FS/c20-17-13-11-16(12-14-17)19(15-7-3-1-4-8-15)21-18-9-5-2-6-10-18/h1,3-4,7-8,11-14,18-19H,2,5-6,9-10H2/t19-/m1/s1 |
| InChIKey | BQUGIQKAGHBHBV-LJQANCHMSA-N |
| XLogP | 5.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |