C16H24O2S — CID 46211076
(1R,2S)-1-cyclohexylsulfanyl-3-methoxy-1-phenylpropan-2-ol (PubChem CID 46211076) has the molecular formula C16H24O2S and a molecular weight of 280.43 g/mol. Its IUPAC name is (1R,2S)-1-cyclohexylsulfanyl-3-methoxy-1-phenylpropan-2-ol.
| Compound Name | (1R,2S)-1-cyclohexylsulfanyl-3-methoxy-1-phenylpropan-2-ol |
|---|---|
| PubChem CID | 46211076 |
| Molecular Formula | C16H24O2S |
| Molecular Weight | 280.43 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | (1R,2S)-1-cyclohexylsulfanyl-3-methoxy-1-phenylpropan-2-ol |
| SMILES | COC[C@H](O)[C@H](SC1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C16H24O2S/c1-18-12-15(17)16(13-8-4-2-5-9-13)19-14-10-6-3-7-11-14/h2,4-5,8-9,14-17H,3,6-7,10-12H2,1H3/t15-,16+/m0/s1 |
| InChIKey | ZUGNFUWETIVMGN-JKSUJKDBSA-N |
| XLogP | 3.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.43 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |