C66H78B3O6P3 — CID 139199421
[[(1S,2S)-1-hydroxy-3-methoxy-1-phenylpropan-2-yl]-diphenylphosphaniumyl]boranuide (PubChem CID 139199421) has the molecular formula C66H78B3O6P3 and a molecular weight of 1092.70 g/mol. Its IUPAC name is [[(1S,2S)-1-hydroxy-3-methoxy-1-phenylpropan-2-yl]-diphenylphosphaniumyl]boranuide.
| Compound Name | [[(1S,2S)-1-hydroxy-3-methoxy-1-phenylpropan-2-yl]-diphenylphosphaniumyl]boranuide |
|---|---|
| PubChem CID | 139199421 |
| Molecular Formula | C66H78B3O6P3 |
| Molecular Weight | 1092.70 g/mol |
| Exact Mass | 1092.53 |
| IUPAC Name | [[(1S,2S)-1-hydroxy-3-methoxy-1-phenylpropan-2-yl]-diphenylphosphaniumyl]boranuide |
| SMILES | [BH3-][P+](c1ccccc1)(c1ccccc1)[C@@H](COC)[C@@H](O)c1ccccc1.[BH3-][P+](c1ccccc1)(c1ccccc1)[C@@H](COC)[C@@H](O)c1ccccc1.[BH3-][P+](c1ccccc1)(c1ccccc1)[C@@H](COC)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/3C22H26BO2P/c3*1-25-17-21(22(24)18-11-5-2-6-12-18)26(23,19-13-7-3-8-14-19)20-15-9-4-10-16-20/h3*2-16,21-22,24H,17H2,1,23H3/t3*21-,22-/m000/s1 |
| InChIKey | KCTIJKFTEJPRDL-CGKBEQHYSA-N |
| XLogP | 8.05 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1092.70 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|