C21H20O3 — CID 134849604
ethyl (2R,3R)-2-benzoyl-3-(2-methylphenyl)pent-4-ynoate (PubChem CID 134849604) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is ethyl (2R,3R)-2-benzoyl-3-(2-methylphenyl)pent-4-ynoate.
| Compound Name | ethyl (2R,3R)-2-benzoyl-3-(2-methylphenyl)pent-4-ynoate |
|---|---|
| PubChem CID | 134849604 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | ethyl (2R,3R)-2-benzoyl-3-(2-methylphenyl)pent-4-ynoate |
| SMILES | C#C[C@H](c1ccccc1C)[C@@H](C(=O)OCC)C(=O)c1ccccc1 |
| InChI | InChI=1S/C21H20O3/c1-4-17(18-14-10-9-11-15(18)3)19(21(23)24-5-2)20(22)16-12-7-6-8-13-16/h1,6-14,17,19H,5H2,2-3H3/t17-,19-/m1/s1 |
| InChIKey | FAEJPSVJJASNSV-IEBWSBKVSA-N |
| XLogP | 3.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|