C19H21N3O2 — CID 134849945
trans-(1S,2S)-2-[4-(2-methoxynaphthalen-1-yl)triazol-1-yl]cyclohexan-1-ol (PubChem CID 134849945) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is trans-(1S,2S)-2-[4-(2-methoxynaphthalen-1-yl)triazol-1-yl]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[4-(2-methoxynaphthalen-1-yl)triazol-1-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 134849945 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | trans-(1S,2S)-2-[4-(2-methoxynaphthalen-1-yl)triazol-1-yl]cyclohexan-1-ol |
| SMILES | COc1ccc2ccccc2c1-c1cn([C@H]2CCCC[C@@H]2O)nn1 |
| InChI | InChI=1S/C19H21N3O2/c1-24-18-11-10-13-6-2-3-7-14(13)19(18)15-12-22(21-20-15)16-8-4-5-9-17(16)23/h2-3,6-7,10-12,16-17,23H,4-5,8-9H2,1H3/t16-,17-/m0/s1 |
| InChIKey | WYEGZGQQJMEFCI-IRXDYDNUSA-N |
| XLogP | 3.58 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |