C22H25BrN2 — CID 134850253
N-[1-adamantyl(phenyl)methyl]-5-bromopyridin-2-amine (PubChem CID 134850253) has the molecular formula C22H25BrN2 and a molecular weight of 397.36 g/mol. Its IUPAC name is N-[1-adamantyl(phenyl)methyl]-5-bromopyridin-2-amine.
| Compound Name | N-[1-adamantyl(phenyl)methyl]-5-bromopyridin-2-amine |
|---|---|
| PubChem CID | 134850253 |
| Molecular Formula | C22H25BrN2 |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[1-adamantyl(phenyl)methyl]-5-bromopyridin-2-amine |
| SMILES | Brc1ccc(NC(c2ccccc2)C23CC4CC(CC(C4)C2)C3)nc1 |
| InChI | InChI=1S/C22H25BrN2/c23-19-6-7-20(24-14-19)25-21(18-4-2-1-3-5-18)22-11-15-8-16(12-22)10-17(9-15)13-22/h1-7,14-17,21H,8-13H2,(H,24,25) |
| InChIKey | XNURKWMQTMGUBM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |