C14H14BrN3S — CID 2429552
Thiourea, N-(5-bromo-2-pyridinyl)-N'-(2-phenylethyl)- (PubChem CID 2429552) has the molecular formula C14H14BrN3S and a molecular weight of 336.25 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-(2-phenylethyl)thiourea.
| Compound Name | Thiourea, N-(5-bromo-2-pyridinyl)-N'-(2-phenylethyl)- |
|---|---|
| PubChem CID | 2429552 |
| Molecular Formula | C14H14BrN3S |
| Molecular Weight | 336.25 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-(2-phenylethyl)thiourea |
| SMILES | C1=CC=C(C=C1)CCNC(=S)NC2=NC=C(C=C2)Br |
| InChI | InChI=1S/C14H14BrN3S/c15-12-6-7-13(17-10-12)18-14(19)16-9-8-11-4-2-1-3-5-11/h1-7,10H,8-9H2,(H2,16,17,18,19) |
| InChIKey | FKDHVFZSRUETTG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 69.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | 282 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.25 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|