C16H17BrFN3OS — CID 3001125
1-(5-bromo-2-pyridinyl)-3-[2-(2-ethoxy-6-fluorophenyl)ethyl]thiourea (PubChem CID 3001125) has the molecular formula C16H17BrFN3OS and a molecular weight of 398.30 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-[2-(2-ethoxy-6-fluorophenyl)ethyl]thiourea.
| Compound Name | 1-(5-bromo-2-pyridinyl)-3-[2-(2-ethoxy-6-fluorophenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 3001125 |
| Molecular Formula | C16H17BrFN3OS |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-[2-(2-ethoxy-6-fluorophenyl)ethyl]thiourea |
| SMILES | CCOc1cccc(F)c1CCNC(=S)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C16H17BrFN3OS/c1-2-22-14-5-3-4-13(18)12(14)8-9-19-16(23)21-15-7-6-11(17)10-20-15/h3-7,10H,2,8-9H2,1H3,(H2,19,20,21,23) |
| InChIKey | IRIOIFXUMMFCIQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|