C13H15FN4OS — CID 19703263
1-[2-(2-fluoro-6-methoxyphenyl)ethyl]-3-(1H-imidazol-2-yl)thiourea (PubChem CID 19703263) has the molecular formula C13H15FN4OS and a molecular weight of 294.36 g/mol. Its IUPAC name is 1-[2-(2-fluoro-6-methoxyphenyl)ethyl]-3-(1H-imidazol-2-yl)thiourea.
| Compound Name | 1-[2-(2-fluoro-6-methoxyphenyl)ethyl]-3-(1H-imidazol-2-yl)thiourea |
|---|---|
| PubChem CID | 19703263 |
| Molecular Formula | C13H15FN4OS |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 1-[2-(2-fluoro-6-methoxyphenyl)ethyl]-3-(1H-imidazol-2-yl)thiourea |
| SMILES | COc1cccc(F)c1CCNC(=S)Nc1ncc[nH]1 |
| InChI | InChI=1S/C13H15FN4OS/c1-19-11-4-2-3-10(14)9(11)5-6-17-13(20)18-12-15-7-8-16-12/h2-4,7-8H,5-6H2,1H3,(H3,15,16,17,18,20) |
| InChIKey | KPMBXMZPKWYUIN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 61.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|