C12H11BrClN3S2 — CID 11474357
1-(5-bromo-2-pyridinyl)-3-[2-(5-chlorothiophen-2-yl)ethyl]thiourea (PubChem CID 11474357) has the molecular formula C12H11BrClN3S2 and a molecular weight of 376.73 g/mol. Its IUPAC name is 1-(5-bromo-2-pyridinyl)-3-[2-(5-chlorothiophen-2-yl)ethyl]thiourea.
| Compound Name | 1-(5-bromo-2-pyridinyl)-3-[2-(5-chlorothiophen-2-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 11474357 |
| Molecular Formula | C12H11BrClN3S2 |
| Molecular Weight | 376.73 g/mol |
| Exact Mass | 374.93 |
| IUPAC Name | 1-(5-bromo-2-pyridinyl)-3-[2-(5-chlorothiophen-2-yl)ethyl]thiourea |
| SMILES | S=C(NCCc1ccc(Cl)s1)Nc1ccc(Br)cn1 |
| InChI | InChI=1S/C12H11BrClN3S2/c13-8-1-4-11(16-7-8)17-12(18)15-6-5-9-2-3-10(14)19-9/h1-4,7H,5-6H2,(H2,15,16,17,18) |
| InChIKey | DXJBZOPFXULJGA-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.73 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|