C18H14F2N2O5 — CID 134850332
2-[(2S,3R,4S)-2,4-difluoro-3-hydroxy-4-(4-nitrophenyl)butyl]isoindole-1,3-dione (PubChem CID 134850332) has the molecular formula C18H14F2N2O5 and a molecular weight of 376.32 g/mol. Its IUPAC name is 2-[(2S,3R,4S)-2,4-difluoro-3-hydroxy-4-(4-nitrophenyl)butyl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3R,4S)-2,4-difluoro-3-hydroxy-4-(4-nitrophenyl)butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 134850332 |
| Molecular Formula | C18H14F2N2O5 |
| Molecular Weight | 376.32 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 2-[(2S,3R,4S)-2,4-difluoro-3-hydroxy-4-(4-nitrophenyl)butyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C[C@H](F)[C@H](O)[C@@H](F)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H14F2N2O5/c19-14(9-21-17(24)12-3-1-2-4-13(12)18(21)25)16(23)15(20)10-5-7-11(8-6-10)22(26)27/h1-8,14-16,23H,9H2/t14-,15-,16-/m0/s1 |
| InChIKey | ADNUOQCEKHPZGA-JYJNAYRXSA-N |
| XLogP | 2.60 |
| TPSA | 100.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.32 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|