C23H29NO9 — CID 134850902
dipropan-2-yl 2-(2-methoxy-1,3-dioxo-4-propan-2-yloxycarbonylisoquinolin-4-yl)propanedioate (PubChem CID 134850902) has the molecular formula C23H29NO9 and a molecular weight of 463.48 g/mol. Its IUPAC name is dipropan-2-yl 2-(2-methoxy-1,3-dioxo-4-propan-2-yloxycarbonylisoquinolin-4-yl)propanedioate.
| Compound Name | dipropan-2-yl 2-(2-methoxy-1,3-dioxo-4-propan-2-yloxycarbonylisoquinolin-4-yl)propanedioate |
|---|---|
| PubChem CID | 134850902 |
| Molecular Formula | C23H29NO9 |
| Molecular Weight | 463.48 g/mol |
| Exact Mass | 463.18 |
| IUPAC Name | dipropan-2-yl 2-(2-methoxy-1,3-dioxo-4-propan-2-yloxycarbonylisoquinolin-4-yl)propanedioate |
| SMILES | CON1C(=O)c2ccccc2C(C(=O)OC(C)C)(C(C(=O)OC(C)C)C(=O)OC(C)C)C1=O |
| InChI | InChI=1S/C23H29NO9/c1-12(2)31-19(26)17(20(27)32-13(3)4)23(22(29)33-14(5)6)16-11-9-8-10-15(16)18(25)24(30-7)21(23)28/h8-14,17H,1-7H3 |
| InChIKey | GRDJXHLSUWKHDH-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 125.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|