C18H15BrF3NO2 — CID 134850920
methyl (Z)-3-(4-bromophenyl)-4-[2-(trifluoromethyl)anilino]but-2-enoate (PubChem CID 134850920) has the molecular formula C18H15BrF3NO2 and a molecular weight of 414.22 g/mol. Its IUPAC name is methyl (Z)-3-(4-bromophenyl)-4-[2-(trifluoromethyl)anilino]but-2-enoate.
| Compound Name | methyl (Z)-3-(4-bromophenyl)-4-[2-(trifluoromethyl)anilino]but-2-enoate |
|---|---|
| PubChem CID | 134850920 |
| Molecular Formula | C18H15BrF3NO2 |
| Molecular Weight | 414.22 g/mol |
| Exact Mass | 413.02 |
| IUPAC Name | methyl (Z)-3-(4-bromophenyl)-4-[2-(trifluoromethyl)anilino]but-2-enoate |
| SMILES | COC(=O)/C=C(\CNc1ccccc1C(F)(F)F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H15BrF3NO2/c1-25-17(24)10-13(12-6-8-14(19)9-7-12)11-23-16-5-3-2-4-15(16)18(20,21)22/h2-10,23H,11H2,1H3/b13-10+ |
| InChIKey | MODGWXHVRLXHEA-JLHYYAGUSA-N |
| XLogP | 5.14 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.22 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|